Skip to main content

Count Operations to Obtain Zero

LeetCode 2288 | Difficulty: Easy​

Easy

Problem Description​

You are given two non-negative integers num1 and num2.

In one operation, if num1 >= num2, you must subtract num2 from num1, otherwise subtract num1 from num2.

  • For example, if num1 = 5 and num2 = 4, subtract num2 from num1, thus obtaining num1 = 1 and num2 = 4. However, if num1 = 4 and num2 = 5, after one operation, num1 = 4 and num2 = 1.

Return the number of operations required to make either num1 = 0 or num2 = 0.

Example 1:

Input: num1 = 2, num2 = 3
Output: 3
Explanation:
- Operation 1: num1 = 2, num2 = 3. Since num1 num2, we subtract num2 from num1.
- Operation 3: num1 = 1, num2 = 1. Since num1 == num2, we subtract num2 from num1.
Now num1 = 0 and num2 = 1. Since num1 == 0, we do not need to perform any further operations.
So the total number of operations required is 3.

Example 2:

Input: num1 = 10, num2 = 10
Output: 1
Explanation:
- Operation 1: num1 = 10, num2 = 10. Since num1 == num2, we subtract num2 from num1 and get num1 = 10 - 10 = 0.
Now num1 = 0 and num2 = 10. Since num1 == 0, we are done.
So the total number of operations required is 1.

Constraints:

  • 0 <= num1, num2 <= 10^5

Topics: Math, Simulation


Approach​

Mathematical​

Look for mathematical patterns or formulas. Consider: modular arithmetic, GCD/LCM, prime factorization, combinatorics, or geometric properties.

When to use

Problems with clear mathematical structure, counting, number properties.


Solutions​

Solution 1: C# (Best: 37 ms)​

MetricValue
Runtime37 ms
Memory25.1 MB
Date2022-02-13
Solution
public class Solution {
public int CountOperations(int num1, int num2) {
int moves = 0;
while(num1!= 0 && num2 != 0)
{
if(num1>num2) num1 = num1 - num2;
else num2 = num2-num1;
moves++;
}
return moves;
}
}

Complexity Analysis​

ApproachTimeSpace
SolutionO(n)O(n)O(1)toO(n)O(1) to O(n)

Interview Tips​

Key Points
  • Start by clarifying edge cases: empty input, single element, all duplicates.
  • LeetCode provides 2 hint(s) for this problem β€” try solving without them first.
πŸ’‘ Hints

Hint 1: Try simulating the process until either of the two integers is zero.

Hint 2: Count the number of operations done.